C14H18N4OS — CID 143301318
ethane;3-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazol-5-yl]-4H-1,2,4-thiadiazol-5-one (PubChem CID 143301318) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is ethane;3-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazol-5-yl]-4H-1,2,4-thiadiazol-5-one.
| Compound Name | ethane;3-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazol-5-yl]-4H-1,2,4-thiadiazol-5-one |
|---|---|
| PubChem CID | 143301318 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | ethane;3-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrazol-5-yl]-4H-1,2,4-thiadiazol-5-one |
| SMILES | C=C/C=C(\C=C/C)c1cc(-c2nsc(=O)[nH]2)[nH]n1.CC |
| InChI | InChI=1S/C12H12N4OS.C2H6/c1-3-5-8(6-4-2)9-7-10(15-14-9)11-13-12(17)18-16-11;1-2/h3-7H,1H2,2H3,(H,14,15)(H,13,16,17);1-2H3/b6-4-,8-5+; |
| InChIKey | MZQKORKAFRFFDY-CSXGQTSLSA-N |
| XLogP | 3.39 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|