C32H28Br2F6O6 — CID 143301613
1-(bromomethyl)-2-[2-(bromomethyl)-4,5,6-trimethoxy-3-(3,4,5-trifluorocyclohexa-2,4-dien-1-yl)phenyl]-3,4,5-trimethoxy-6-(3,4,5-trifluorophenyl)benzene (PubChem CID 143301613) has the molecular formula C32H28Br2F6O6 and a molecular weight of 782.37 g/mol. Its IUPAC name is 1-(bromomethyl)-2-[2-(bromomethyl)-4,5,6-trimethoxy-3-(3,4,5-trifluorocyclohexa-2,4-dien-1-yl)phenyl]-3,4,5-trimethoxy-6-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 1-(bromomethyl)-2-[2-(bromomethyl)-4,5,6-trimethoxy-3-(3,4,5-trifluorocyclohexa-2,4-dien-1-yl)phenyl]-3,4,5-trimethoxy-6-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 143301613 |
| Molecular Formula | C32H28Br2F6O6 |
| Molecular Weight | 782.37 g/mol |
| Exact Mass | 780.02 |
| IUPAC Name | 1-(bromomethyl)-2-[2-(bromomethyl)-4,5,6-trimethoxy-3-(3,4,5-trifluorocyclohexa-2,4-dien-1-yl)phenyl]-3,4,5-trimethoxy-6-(3,4,5-trifluorophenyl)benzene |
| SMILES | COc1c(OC)c(-c2cc(F)c(F)c(F)c2)c(CBr)c(-c2c(CBr)c(C3C=C(F)C(F)=C(F)C3)c(OC)c(OC)c2OC)c1OC |
| InChI | InChI=1S/C32H28Br2F6O6/c1-41-27-21(13-7-17(35)25(39)18(36)8-13)15(11-33)23(29(43-3)31(27)45-5)24-16(12-34)22(14-9-19(37)26(40)20(38)10-14)28(42-2)32(46-6)30(24)44-4/h7-9,14H,10-12H2,1-6H3 |
| InChIKey | DJNRISIRGMRMKX-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.37 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|