C20H23F8N5O3 — CID 143301900
(6S)-6-methyl-4-[(2S)-2-(methylamino)-4-oxo-4-[2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]butyl]morpholin-3-one (PubChem CID 143301900) has the molecular formula C20H23F8N5O3 and a molecular weight of 533.42 g/mol. Its IUPAC name is (6S)-6-methyl-4-[(2S)-2-(methylamino)-4-oxo-4-[2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]butyl]morpholin-3-one.
| Compound Name | (6S)-6-methyl-4-[(2S)-2-(methylamino)-4-oxo-4-[2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]butyl]morpholin-3-one |
|---|---|
| PubChem CID | 143301900 |
| Molecular Formula | C20H23F8N5O3 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | (6S)-6-methyl-4-[(2S)-2-(methylamino)-4-oxo-4-[2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]butyl]morpholin-3-one |
| SMILES | CN[C@@H](CC(=O)N1CCc2c(nc(C(F)(F)C(F)(F)F)nc2C(F)(F)F)C1)CN1C[C@H](C)OCC1=O |
| InChI | InChI=1S/C20H23F8N5O3/c1-10-6-33(15(35)9-36-10)7-11(29-2)5-14(34)32-4-3-12-13(8-32)30-17(18(21,22)20(26,27)28)31-16(12)19(23,24)25/h10-11,29H,3-9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | HTBRXOCLQHNEAT-QWRGUYRKSA-N |
| XLogP | 2.26 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|