C29H30FNO2 — CID 143302108
7a-(4-fluorophenyl)-2-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]-2-[2-[(Z)-prop-1-enyl]phenyl]-6,7-dihydro-3H-pyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 143302108) has the molecular formula C29H30FNO2 and a molecular weight of 443.56 g/mol. Its IUPAC name is 7a-(4-fluorophenyl)-2-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]-2-[2-[(Z)-prop-1-enyl]phenyl]-6,7-dihydro-3H-pyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | 7a-(4-fluorophenyl)-2-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]-2-[2-[(Z)-prop-1-enyl]phenyl]-6,7-dihydro-3H-pyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 143302108 |
| Molecular Formula | C29H30FNO2 |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 7a-(4-fluorophenyl)-2-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]-2-[2-[(Z)-prop-1-enyl]phenyl]-6,7-dihydro-3H-pyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | C=C/C=C\C(C)=C(/C)C1(c2ccccc2/C=C\C)CN2C(=O)CCC2(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C29H30FNO2/c1-5-7-11-21(3)22(4)28(26-13-9-8-12-23(26)10-6-2)20-31-27(32)18-19-29(31,33-28)24-14-16-25(30)17-15-24/h5-17H,1,18-20H2,2-4H3/b10-6-,11-7-,22-21+ |
| InChIKey | JZGBKGQFUGJIJP-DAXRTCQJSA-N |
| XLogP | 6.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|