C15H17N3 — CID 143303220
2-[(E)-3-(3,4-dihydropyridin-5-yl)prop-2-enimidoyl]bicyclo[4.1.0]hepta-2,4-dien-1-amine (PubChem CID 143303220) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-[(E)-3-(3,4-dihydropyridin-5-yl)prop-2-enimidoyl]bicyclo[4.1.0]hepta-2,4-dien-1-amine.
| Compound Name | 2-[(E)-3-(3,4-dihydropyridin-5-yl)prop-2-enimidoyl]bicyclo[4.1.0]hepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143303220 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-[(E)-3-(3,4-dihydropyridin-5-yl)prop-2-enimidoyl]bicyclo[4.1.0]hepta-2,4-dien-1-amine |
| SMILES | [H]/N=C(\C=C\C1=CN=CCC1)C1=CC=CC2CC12N |
| InChI | InChI=1S/C15H17N3/c16-14(7-6-11-3-2-8-18-10-11)13-5-1-4-12-9-15(12,13)17/h1,4-8,10,12,16H,2-3,9,17H2/b7-6+,16-14+ |
| InChIKey | SVRKOKARGQLBKM-DBSWOVOKSA-N |
| XLogP | 2.52 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|