C26H22F2N6O2 — CID 143303857
4,6-difluoro-N-[2-[6-(methoxymethyl)-1,5-naphthyridin-4-yl]-4,5,6,7-tetrahydroindazol-5-yl]-1H-indole-2-carboxamide (PubChem CID 143303857) has the molecular formula C26H22F2N6O2 and a molecular weight of 488.50 g/mol. Its IUPAC name is 4,6-difluoro-N-[2-[6-(methoxymethyl)-1,5-naphthyridin-4-yl]-4,5,6,7-tetrahydroindazol-5-yl]-1H-indole-2-carboxamide.
| Compound Name | 4,6-difluoro-N-[2-[6-(methoxymethyl)-1,5-naphthyridin-4-yl]-4,5,6,7-tetrahydroindazol-5-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143303857 |
| Molecular Formula | C26H22F2N6O2 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 4,6-difluoro-N-[2-[6-(methoxymethyl)-1,5-naphthyridin-4-yl]-4,5,6,7-tetrahydroindazol-5-yl]-1H-indole-2-carboxamide |
| SMILES | COCc1ccc2nccc(-n3cc4c(n3)CCC(NC(=O)c3cc5c(F)cc(F)cc5[nH]3)C4)c2n1 |
| InChI | InChI=1S/C26H22F2N6O2/c1-36-13-17-3-5-21-25(30-17)24(6-7-29-21)34-12-14-8-16(2-4-20(14)33-34)31-26(35)23-11-18-19(28)9-15(27)10-22(18)32-23/h3,5-7,9-12,16,32H,2,4,8,13H2,1H3,(H,31,35) |
| InChIKey | ACPQXEMTIURGPA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |