About N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride
N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride (PubChem CID 14330486) has the molecular formula C12H18ClNOS
and a molecular weight of 259.80 g/mol. Its IUPAC name is N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride.
Molecular Properties
| Compound Name | N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride |
| PubChem CID | 14330486 |
| Molecular Formula | C12H18ClNOS |
| Molecular Weight | 259.80 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride |
| SMILES | CCNC1CSc2cccc(OC)c2C1.Cl |
| InChI | InChI=1S/C12H17NOS.ClH/c1-3-13-9-7-10-11(14-2)5-4-6-12(10)15-8-9;/h4-6,9,13H,3,7-8H2,1-2H3;1H |
| InChIKey | BMMGXHIFTDCOML-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride?
The IUPAC name of N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride (CID 14330486) is N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride.
What is the SMILES notation for N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride?
The canonical SMILES for N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride is CCNC1CSc2cccc(OC)c2C1.Cl.
What is the InChIKey of N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride?
The InChIKey is BMMGXHIFTDCOML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NOS.ClH/c1-3-13-9-7-10-11(14-2)5-4-6-12(10)15-8-9;/h4-6,9,13H,3,7-8H2,1-2H3;1H.
What are the key properties of N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride?
N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride has a molecular weight of 259.80 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-methoxy-3,4-dihydro-2H-thiochromen-3-amine;hydrochloride is sourced from PubChem (CID 14330486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).