C10H14F3N3 — CID 143304969
1-[3-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine (PubChem CID 143304969) has the molecular formula C10H14F3N3 and a molecular weight of 233.24 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine.
| Compound Name | 1-[3-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine |
|---|---|
| PubChem CID | 143304969 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 1-[3-(trifluoromethyl)-1,2-dihydropyridin-2-yl]piperazine |
| SMILES | FC(F)(F)C1=CC=CNC1N1CCNCC1 |
| InChI | InChI=1S/C10H14F3N3/c11-10(12,13)8-2-1-3-15-9(8)16-6-4-14-5-7-16/h1-3,9,14-15H,4-7H2 |
| InChIKey | UPZGAHYNHFGVSR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |