C14H26NOP — CID 143305049
[(2Z,4Z)-2-methyl-1-(piperidin-4-ylmethoxy)hepta-2,4-dien-3-yl]phosphane (PubChem CID 143305049) has the molecular formula C14H26NOP and a molecular weight of 255.34 g/mol. Its IUPAC name is [(2Z,4Z)-2-methyl-1-(piperidin-4-ylmethoxy)hepta-2,4-dien-3-yl]phosphane.
| Compound Name | [(2Z,4Z)-2-methyl-1-(piperidin-4-ylmethoxy)hepta-2,4-dien-3-yl]phosphane |
|---|---|
| PubChem CID | 143305049 |
| Molecular Formula | C14H26NOP |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | [(2Z,4Z)-2-methyl-1-(piperidin-4-ylmethoxy)hepta-2,4-dien-3-yl]phosphane |
| SMILES | CC/C=C\C(P)=C(/C)COCC1CCNCC1 |
| InChI | InChI=1S/C14H26NOP/c1-3-4-5-14(17)12(2)10-16-11-13-6-8-15-9-7-13/h4-5,13,15H,3,6-11,17H2,1-2H3/b5-4-,14-12- |
| InChIKey | UDFYJDUYPOCXEM-ZLUSXAHMSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|