About [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide
[3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide (PubChem CID 14330508) has the molecular formula C20H32BrNO3
and a molecular weight of 414.38 g/mol. Its IUPAC name is [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide.
Molecular Properties
| Compound Name | [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide |
| PubChem CID | 14330508 |
| Molecular Formula | C20H32BrNO3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide |
| SMILES | Br.CCCN(CCC)C1COc2cccc(OC(=O)C(C)(C)C)c2C1 |
| InChI | InChI=1S/C20H31NO3.BrH/c1-6-11-21(12-7-2)15-13-16-17(23-14-15)9-8-10-18(16)24-19(22)20(3,4)5;/h8-10,15H,6-7,11-14H2,1-5H3;1H |
| InChIKey | UJZWOTNPRNYVPO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide?
The IUPAC name of [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide (CID 14330508) is [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide.
What is the SMILES notation for [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide?
The canonical SMILES for [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide is Br.CCCN(CCC)C1COc2cccc(OC(=O)C(C)(C)C)c2C1.
What is the InChIKey of [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide?
The InChIKey is UJZWOTNPRNYVPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31NO3.BrH/c1-6-11-21(12-7-2)15-13-16-17(23-14-15)9-8-10-18(16)24-19(22)20(3,4)5;/h8-10,15H,6-7,11-14H2,1-5H3;1H.
What are the key properties of [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide?
[3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide has a molecular weight of 414.38 g/mol, XLogP of 4.64, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl] 2,2-dimethylpropanoate;hydrobromide is sourced from PubChem (CID 14330508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).