C9H9FN2O3 — CID 143305098
9-fluoro-7-nitro-1,2,4,5-tetrahydro-3,1-benzoxazepine (PubChem CID 143305098) has the molecular formula C9H9FN2O3 and a molecular weight of 212.18 g/mol. Its IUPAC name is 9-fluoro-7-nitro-1,2,4,5-tetrahydro-3,1-benzoxazepine.
| Compound Name | 9-fluoro-7-nitro-1,2,4,5-tetrahydro-3,1-benzoxazepine |
|---|---|
| PubChem CID | 143305098 |
| Molecular Formula | C9H9FN2O3 |
| Molecular Weight | 212.18 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 9-fluoro-7-nitro-1,2,4,5-tetrahydro-3,1-benzoxazepine |
| SMILES | O=[N+]([O-])c1cc(F)c2c(c1)CCOCN2 |
| InChI | InChI=1S/C9H9FN2O3/c10-8-4-7(12(13)14)3-6-1-2-15-5-11-9(6)8/h3-4,11H,1-2,5H2 |
| InChIKey | OBDOMHDSSPDGRY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|