About 2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene
2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene (PubChem CID 143305957) has the molecular formula C8H8Cl2S
and a molecular weight of 207.13 g/mol. Its IUPAC name is 2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene.
Analyze 2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene?
The IUPAC name of 2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene (CID 143305957) is 2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene.
What is the SMILES notation for 2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene?
The canonical SMILES for 2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene is CSC1=C(Cl)C=CCC=C1Cl.
What is the InChIKey of 2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene?
The InChIKey is QFFJXNQIQFGTGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2S/c1-11-8-6(9)4-2-3-5-7(8)10/h2,4-5H,3H2,1H3.
What are the key properties of 2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene?
2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene has a molecular weight of 207.13 g/mol, XLogP of 3.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-3-methylsulfanylcyclohepta-1,3,5-triene is sourced from PubChem (CID 143305957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).