About 2-heptoxy-N,N-dimethylethanamine
2-heptoxy-N,N-dimethylethanamine (PubChem CID 14330631) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is 2-heptoxy-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-heptoxy-N,N-dimethylethanamine |
| PubChem CID | 14330631 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 2-heptoxy-N,N-dimethylethanamine |
| SMILES | CCCCCCCOCCN(C)C |
| InChI | InChI=1S/C11H25NO/c1-4-5-6-7-8-10-13-11-9-12(2)3/h4-11H2,1-3H3 |
| InChIKey | RUOIDUVXLQMCLH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-heptoxy-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptoxy-N,N-dimethylethanamine?
The IUPAC name of 2-heptoxy-N,N-dimethylethanamine (CID 14330631) is 2-heptoxy-N,N-dimethylethanamine.
What is the SMILES notation for 2-heptoxy-N,N-dimethylethanamine?
The canonical SMILES for 2-heptoxy-N,N-dimethylethanamine is CCCCCCCOCCN(C)C.
What is the InChIKey of 2-heptoxy-N,N-dimethylethanamine?
The InChIKey is RUOIDUVXLQMCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO/c1-4-5-6-7-8-10-13-11-9-12(2)3/h4-11H2,1-3H3.
What are the key properties of 2-heptoxy-N,N-dimethylethanamine?
2-heptoxy-N,N-dimethylethanamine has a molecular weight of 187.33 g/mol, XLogP of 2.54, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptoxy-N,N-dimethylethanamine is sourced from PubChem (CID 14330631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).