C11H18N2O — CID 143306505
[(4E,5Z)-4-ethylideneocta-5,7-dien-3-yl]urea (PubChem CID 143306505) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is [(4E,5Z)-4-ethylideneocta-5,7-dien-3-yl]urea.
| Compound Name | [(4E,5Z)-4-ethylideneocta-5,7-dien-3-yl]urea |
|---|---|
| PubChem CID | 143306505 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | [(4E,5Z)-4-ethylideneocta-5,7-dien-3-yl]urea |
| SMILES | C=C/C=C\C(=C/C)C(CC)NC(N)=O |
| InChI | InChI=1S/C11H18N2O/c1-4-7-8-9(5-2)10(6-3)13-11(12)14/h4-5,7-8,10H,1,6H2,2-3H3,(H3,12,13,14)/b8-7-,9-5+ |
| InChIKey | SJOPHTCJNRNYAZ-ISXYNVPDSA-N |
| XLogP | 2.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|