About N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide
N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide (PubChem CID 143306518) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide.
Molecular Properties
| Compound Name | N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide |
| PubChem CID | 143306518 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide |
| SMILES | C/C=C\C=C/CNC(C)=S |
| InChI | InChI=1S/C8H13NS/c1-3-4-5-6-7-9-8(2)10/h3-6H,7H2,1-2H3,(H,9,10)/b4-3-,6-5- |
| InChIKey | UNLHUNKKAFEJEJ-OUPQRBNQSA-N |
| XLogP | 2.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide?
The IUPAC name of N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide (CID 143306518) is N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide.
What is the SMILES notation for N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide?
The canonical SMILES for N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide is C/C=C\C=C/CNC(C)=S.
What is the InChIKey of N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide?
The InChIKey is UNLHUNKKAFEJEJ-OUPQRBNQSA-N. The full InChI is InChI=1S/C8H13NS/c1-3-4-5-6-7-9-8(2)10/h3-6H,7H2,1-2H3,(H,9,10)/b4-3-,6-5-.
What are the key properties of N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide?
N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide has a molecular weight of 155.27 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z,4Z)-hexa-2,4-dienyl]ethanethioamide is sourced from PubChem (CID 143306518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).