C11H21NO — CID 143306575
ethane;(3Z,5E)-5-(ethylamino)hepta-1,3,5-trien-2-ol (PubChem CID 143306575) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is ethane;(3Z,5E)-5-(ethylamino)hepta-1,3,5-trien-2-ol.
| Compound Name | ethane;(3Z,5E)-5-(ethylamino)hepta-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 143306575 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | ethane;(3Z,5E)-5-(ethylamino)hepta-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C/C)NCC.CC |
| InChI | InChI=1S/C9H15NO.C2H6/c1-4-9(10-5-2)7-6-8(3)11;1-2/h4,6-7,10-11H,3,5H2,1-2H3;1-2H3/b7-6-,9-4+; |
| InChIKey | GIBXPIBZZCAWPX-WAYWXQFESA-N |
| XLogP | 3.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|