C16H26FN3O2 — CID 143307514
3-amino-4-[3-[fluoro(propyl)amino]propyl-propan-2-ylamino]benzoic acid (PubChem CID 143307514) has the molecular formula C16H26FN3O2 and a molecular weight of 311.40 g/mol. Its IUPAC name is 3-amino-4-[3-[fluoro(propyl)amino]propyl-propan-2-ylamino]benzoic acid.
| Compound Name | 3-amino-4-[3-[fluoro(propyl)amino]propyl-propan-2-ylamino]benzoic acid |
|---|---|
| PubChem CID | 143307514 |
| Molecular Formula | C16H26FN3O2 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 3-amino-4-[3-[fluoro(propyl)amino]propyl-propan-2-ylamino]benzoic acid |
| SMILES | CCCN(F)CCCN(c1ccc(C(=O)O)cc1N)C(C)C |
| InChI | InChI=1S/C16H26FN3O2/c1-4-8-19(17)9-5-10-20(12(2)3)15-7-6-13(16(21)22)11-14(15)18/h6-7,11-12H,4-5,8-10,18H2,1-3H3,(H,21,22) |
| InChIKey | QOOPNABYZHRJIZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|