C27H22F3N3O2S — CID 143307911
5-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfanylmethyl]-4-methyl-N-(pyridin-3-ylmethoxymethyl)pyridine-2-carboxamide (PubChem CID 143307911) has the molecular formula C27H22F3N3O2S and a molecular weight of 509.55 g/mol. Its IUPAC name is 5-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfanylmethyl]-4-methyl-N-(pyridin-3-ylmethoxymethyl)pyridine-2-carboxamide.
| Compound Name | 5-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfanylmethyl]-4-methyl-N-(pyridin-3-ylmethoxymethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143307911 |
| Molecular Formula | C27H22F3N3O2S |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 5-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfanylmethyl]-4-methyl-N-(pyridin-3-ylmethoxymethyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCOCc2cccnc2)ncc1C(Sc1ccc(F)cc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C27H22F3N3O2S/c1-17-11-25(27(34)33-16-35-15-18-3-2-10-31-13-18)32-14-23(17)26(22-12-20(29)6-9-24(22)30)36-21-7-4-19(28)5-8-21/h2-14,26H,15-16H2,1H3,(H,33,34) |
| InChIKey | YBLRKDBXZJAUHK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|