C18H16F2N4 — CID 143309762
3-[4-[(2,4-difluoro-N-methylanilino)methyl]phenyl]pyrazin-2-amine (PubChem CID 143309762) has the molecular formula C18H16F2N4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-[4-[(2,4-difluoro-N-methylanilino)methyl]phenyl]pyrazin-2-amine.
| Compound Name | 3-[4-[(2,4-difluoro-N-methylanilino)methyl]phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 143309762 |
| Molecular Formula | C18H16F2N4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-[4-[(2,4-difluoro-N-methylanilino)methyl]phenyl]pyrazin-2-amine |
| SMILES | CN(Cc1ccc(-c2nccnc2N)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H16F2N4/c1-24(16-7-6-14(19)10-15(16)20)11-12-2-4-13(5-3-12)17-18(21)23-9-8-22-17/h2-10H,11H2,1H3,(H2,21,23) |
| InChIKey | BJOUVKCKOVIKAH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |