About 6-butan-2-yl-5,7-dioxaspiro[2.5]octane
6-butan-2-yl-5,7-dioxaspiro[2.5]octane (PubChem CID 143310520) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 6-butan-2-yl-5,7-dioxaspiro[2.5]octane.
Molecular Properties
| Compound Name | 6-butan-2-yl-5,7-dioxaspiro[2.5]octane |
| PubChem CID | 143310520 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 6-butan-2-yl-5,7-dioxaspiro[2.5]octane |
| SMILES | CCC(C)C1OCC2(CC2)CO1 |
| InChI | InChI=1S/C10H18O2/c1-3-8(2)9-11-6-10(4-5-10)7-12-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | FABAFWYVVBGAMA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-butan-2-yl-5,7-dioxaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butan-2-yl-5,7-dioxaspiro[2.5]octane?
The IUPAC name of 6-butan-2-yl-5,7-dioxaspiro[2.5]octane (CID 143310520) is 6-butan-2-yl-5,7-dioxaspiro[2.5]octane.
What is the SMILES notation for 6-butan-2-yl-5,7-dioxaspiro[2.5]octane?
The canonical SMILES for 6-butan-2-yl-5,7-dioxaspiro[2.5]octane is CCC(C)C1OCC2(CC2)CO1.
What is the InChIKey of 6-butan-2-yl-5,7-dioxaspiro[2.5]octane?
The InChIKey is FABAFWYVVBGAMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-8(2)9-11-6-10(4-5-10)7-12-9/h8-9H,3-7H2,1-2H3.
What are the key properties of 6-butan-2-yl-5,7-dioxaspiro[2.5]octane?
6-butan-2-yl-5,7-dioxaspiro[2.5]octane has a molecular weight of 170.25 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butan-2-yl-5,7-dioxaspiro[2.5]octane is sourced from PubChem (CID 143310520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).