C19H25N3S3 — CID 143310691
2-(3,6-dihydro-2H-1,4-thiazin-5-yl)-N-(2,3-dihydrothiophen-5-ylsulfanyl)-3-methyl-1H-indol-7-amine;ethane (PubChem CID 143310691) has the molecular formula C19H25N3S3 and a molecular weight of 391.63 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-1,4-thiazin-5-yl)-N-(2,3-dihydrothiophen-5-ylsulfanyl)-3-methyl-1H-indol-7-amine;ethane.
| Compound Name | 2-(3,6-dihydro-2H-1,4-thiazin-5-yl)-N-(2,3-dihydrothiophen-5-ylsulfanyl)-3-methyl-1H-indol-7-amine;ethane |
|---|---|
| PubChem CID | 143310691 |
| Molecular Formula | C19H25N3S3 |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-(3,6-dihydro-2H-1,4-thiazin-5-yl)-N-(2,3-dihydrothiophen-5-ylsulfanyl)-3-methyl-1H-indol-7-amine;ethane |
| SMILES | CC.Cc1c(C2=NCCSC2)[nH]c2c(NSC3=CCCS3)cccc12 |
| InChI | InChI=1S/C17H19N3S3.C2H6/c1-11-12-4-2-5-13(20-23-15-6-3-8-22-15)17(12)19-16(11)14-10-21-9-7-18-14;1-2/h2,4-6,19-20H,3,7-10H2,1H3;1-2H3 |
| InChIKey | MESOGODPLZUPQB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|