C25H26FN5O4 — CID 143310871
N-ethyl-2-[(4S,7R)-5-[(4-fluorophenyl)methyl]-4,7-dimethyl-9-oxo-2-oxa-5,8,15,17-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),11,13,16-tetraen-13-yl]-2-oxoacetamide (PubChem CID 143310871) has the molecular formula C25H26FN5O4 and a molecular weight of 479.51 g/mol. Its IUPAC name is N-ethyl-2-[(4S,7R)-5-[(4-fluorophenyl)methyl]-4,7-dimethyl-9-oxo-2-oxa-5,8,15,17-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),11,13,16-tetraen-13-yl]-2-oxoacetamide.
| Compound Name | N-ethyl-2-[(4S,7R)-5-[(4-fluorophenyl)methyl]-4,7-dimethyl-9-oxo-2-oxa-5,8,15,17-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),11,13,16-tetraen-13-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 143310871 |
| Molecular Formula | C25H26FN5O4 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-ethyl-2-[(4S,7R)-5-[(4-fluorophenyl)methyl]-4,7-dimethyl-9-oxo-2-oxa-5,8,15,17-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),11,13,16-tetraen-13-yl]-2-oxoacetamide |
| SMILES | CCNC(=O)C(=O)c1c[nH]c2nc3c(cc12)C(=O)N1C(O3)[C@H](C)N(Cc2ccc(F)cc2)C[C@H]1C |
| InChI | InChI=1S/C25H26FN5O4/c1-4-27-22(33)20(32)19-10-28-21-17(19)9-18-23(29-21)35-25-14(3)30(11-13(2)31(25)24(18)34)12-15-5-7-16(26)8-6-15/h5-10,13-14,25H,4,11-12H2,1-3H3,(H,27,33)(H,28,29)/t13-,14+,25?/m1/s1 |
| InChIKey | ZYQYUCJLYYQRTE-QFYUUZNTSA-N |
| XLogP | 2.47 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|