About tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane
tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane (PubChem CID 143311065) has the molecular formula C15H24O5
and a molecular weight of 284.35 g/mol. Its IUPAC name is tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane.
Molecular Properties
| Compound Name | tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane |
| PubChem CID | 143311065 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane |
| SMILES | CC.CCOC1=CC(=O)C(C(=O)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H18O5.C2H6/c1-5-17-8-6-9(10(14)7-8)11(15)12(16)18-13(2,3)4;1-2/h7,9H,5-6H2,1-4H3;1-2H3 |
| InChIKey | AYIPCZIQXQNZKH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane?
The IUPAC name of tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane (CID 143311065) is tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane.
What is the SMILES notation for tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane?
The canonical SMILES for tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane is CC.CCOC1=CC(=O)C(C(=O)C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane?
The InChIKey is AYIPCZIQXQNZKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O5.C2H6/c1-5-17-8-6-9(10(14)7-8)11(15)12(16)18-13(2,3)4;1-2/h7,9H,5-6H2,1-4H3;1-2H3.
What are the key properties of tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane?
tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane has a molecular weight of 284.35 g/mol, XLogP of 2.43, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(4-ethoxy-2-oxocyclopent-3-en-1-yl)-2-oxoacetate;ethane is sourced from PubChem (CID 143311065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).