About 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane
1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane (PubChem CID 143311232) has the molecular formula C22H31NO2S
and a molecular weight of 373.56 g/mol. Its IUPAC name is 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane.
Molecular Properties
| Compound Name | 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane |
| PubChem CID | 143311232 |
| Molecular Formula | C22H31NO2S |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane |
| SMILES | CC(=O)c1cccc(CSc2ccccc2O)n1.CCCC(C)CCC |
| InChI | InChI=1S/C14H13NO2S.C8H18/c1-10(16)12-6-4-5-11(15-12)9-18-14-8-3-2-7-13(14)17;1-4-6-8(3)7-5-2/h2-8,17H,9H2,1H3;8H,4-7H2,1-3H3 |
| InChIKey | QOXIBWJHLWCLKP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane?
The IUPAC name of 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane (CID 143311232) is 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane.
What is the SMILES notation for 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane?
The canonical SMILES for 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane is CC(=O)c1cccc(CSc2ccccc2O)n1.CCCC(C)CCC.
What is the InChIKey of 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane?
The InChIKey is QOXIBWJHLWCLKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2S.C8H18/c1-10(16)12-6-4-5-11(15-12)9-18-14-8-3-2-7-13(14)17;1-4-6-8(3)7-5-2/h2-8,17H,9H2,1H3;8H,4-7H2,1-3H3.
What are the key properties of 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane?
1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane has a molecular weight of 373.56 g/mol, XLogP of 6.50, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[(2-hydroxyphenyl)sulfanylmethyl]-2-pyridinyl]ethanone;4-methylheptane is sourced from PubChem (CID 143311232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).