About 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine
2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine (PubChem CID 143311533) has the molecular formula C13H12ClN
and a molecular weight of 217.70 g/mol. Its IUPAC name is 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine.
Molecular Properties
| Compound Name | 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine |
| PubChem CID | 143311533 |
| Molecular Formula | C13H12ClN |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine |
| SMILES | Cc1cccc(C2=CC=CCC=C2Cl)n1 |
| InChI | InChI=1S/C13H12ClN/c1-10-6-5-9-13(15-10)11-7-3-2-4-8-12(11)14/h2-3,5-9H,4H2,1H3 |
| InChIKey | ICAQZKJGOOKZFK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine?
The IUPAC name of 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine (CID 143311533) is 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine.
What is the SMILES notation for 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine?
The canonical SMILES for 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine is Cc1cccc(C2=CC=CCC=C2Cl)n1.
What is the InChIKey of 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine?
The InChIKey is ICAQZKJGOOKZFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN/c1-10-6-5-9-13(15-10)11-7-3-2-4-8-12(11)14/h2-3,5-9H,4H2,1H3.
What are the key properties of 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine?
2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine has a molecular weight of 217.70 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-chlorocyclohepta-1,3,6-trien-1-yl)-6-methylpyridine is sourced from PubChem (CID 143311533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).