C22H28N2O2 — CID 143312452
(3Z)-7-(4-methoxycyclohepta-2,4-dien-1-yl)-3-[(Z)-2-methylbut-2-enylidene]-2-methylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine-6-carbaldehyde (PubChem CID 143312452) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (3Z)-7-(4-methoxycyclohepta-2,4-dien-1-yl)-3-[(Z)-2-methylbut-2-enylidene]-2-methylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine-6-carbaldehyde.
| Compound Name | (3Z)-7-(4-methoxycyclohepta-2,4-dien-1-yl)-3-[(Z)-2-methylbut-2-enylidene]-2-methylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 143312452 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (3Z)-7-(4-methoxycyclohepta-2,4-dien-1-yl)-3-[(Z)-2-methylbut-2-enylidene]-2-methylidene-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine-6-carbaldehyde |
| SMILES | C=c1[nH]c2c(/c1=C/C(C)=C\C)CCN(C=O)C2C1C=CC(OC)=CCC1 |
| InChI | InChI=1S/C22H28N2O2/c1-5-15(2)13-20-16(3)23-21-19(20)11-12-24(14-25)22(21)17-7-6-8-18(26-4)10-9-17/h5,8-10,13-14,17,22-23H,3,6-7,11-12H2,1-2,4H3/b15-5-,20-13+ |
| InChIKey | MWCFJQWQLCWYAR-DQQRAREOSA-N |
| XLogP | 2.72 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|