C24H29ClFN6OP — CID 143313032
N-[1-[6-(3-chloro-4-pyridinyl)-5-(2-fluoro-4-phosphanylphenyl)pyrazin-2-yl]piperidin-4-yl]formamide;N,N-dimethylmethanamine (PubChem CID 143313032) has the molecular formula C24H29ClFN6OP and a molecular weight of 502.96 g/mol. Its IUPAC name is N-[1-[6-(3-chloro-4-pyridinyl)-5-(2-fluoro-4-phosphanylphenyl)pyrazin-2-yl]piperidin-4-yl]formamide;N,N-dimethylmethanamine.
| Compound Name | N-[1-[6-(3-chloro-4-pyridinyl)-5-(2-fluoro-4-phosphanylphenyl)pyrazin-2-yl]piperidin-4-yl]formamide;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 143313032 |
| Molecular Formula | C24H29ClFN6OP |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | N-[1-[6-(3-chloro-4-pyridinyl)-5-(2-fluoro-4-phosphanylphenyl)pyrazin-2-yl]piperidin-4-yl]formamide;N,N-dimethylmethanamine |
| SMILES | CN(C)C.O=CNC1CCN(c2cnc(-c3ccc(P)cc3F)c(-c3ccncc3Cl)n2)CC1 |
| InChI | InChI=1S/C21H20ClFN5OP.C3H9N/c22-17-10-24-6-3-15(17)21-20(16-2-1-14(30)9-18(16)23)25-11-19(27-21)28-7-4-13(5-8-28)26-12-29;1-4(2)3/h1-3,6,9-13H,4-5,7-8,30H2,(H,26,29);1-3H3 |
| InChIKey | FYCSZMPUCWFKRO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|