C23H22Cl2FN5O2 — CID 143313654
2-chloropropan-2-yl 4-[6-(3-chloro-4-pyridinyl)-5-(4-fluorophenyl)pyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 143313654) has the molecular formula C23H22Cl2FN5O2 and a molecular weight of 490.37 g/mol. Its IUPAC name is 2-chloropropan-2-yl 4-[6-(3-chloro-4-pyridinyl)-5-(4-fluorophenyl)pyrazin-2-yl]piperazine-1-carboxylate.
| Compound Name | 2-chloropropan-2-yl 4-[6-(3-chloro-4-pyridinyl)-5-(4-fluorophenyl)pyrazin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143313654 |
| Molecular Formula | C23H22Cl2FN5O2 |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 2-chloropropan-2-yl 4-[6-(3-chloro-4-pyridinyl)-5-(4-fluorophenyl)pyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(Cl)OC(=O)N1CCN(c2cnc(-c3ccc(F)cc3)c(-c3ccncc3Cl)n2)CC1 |
| InChI | InChI=1S/C23H22Cl2FN5O2/c1-23(2,25)33-22(32)31-11-9-30(10-12-31)19-14-28-20(15-3-5-16(26)6-4-15)21(29-19)17-7-8-27-13-18(17)24/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | DXNSPCNLWHHCTD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|