C27H25ClN2O4 — CID 143314034
1-(2-chloro-3-cyclopropylphenyl)-3-[4-[4-[(1R,2R)-2-(dihydroxymethyl)cyclopropanecarbonyl]phenyl]phenyl]urea (PubChem CID 143314034) has the molecular formula C27H25ClN2O4 and a molecular weight of 476.96 g/mol. Its IUPAC name is 1-(2-chloro-3-cyclopropylphenyl)-3-[4-[4-[(1R,2R)-2-(dihydroxymethyl)cyclopropanecarbonyl]phenyl]phenyl]urea.
| Compound Name | 1-(2-chloro-3-cyclopropylphenyl)-3-[4-[4-[(1R,2R)-2-(dihydroxymethyl)cyclopropanecarbonyl]phenyl]phenyl]urea |
|---|---|
| PubChem CID | 143314034 |
| Molecular Formula | C27H25ClN2O4 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 1-(2-chloro-3-cyclopropylphenyl)-3-[4-[4-[(1R,2R)-2-(dihydroxymethyl)cyclopropanecarbonyl]phenyl]phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2ccc(C(=O)[C@@H]3C[C@H]3C(O)O)cc2)cc1)Nc1cccc(C2CC2)c1Cl |
| InChI | InChI=1S/C27H25ClN2O4/c28-24-20(17-6-7-17)2-1-3-23(24)30-27(34)29-19-12-10-16(11-13-19)15-4-8-18(9-5-15)25(31)21-14-22(21)26(32)33/h1-5,8-13,17,21-22,26,32-33H,6-7,14H2,(H2,29,30,34)/t21-,22-/m1/s1 |
| InChIKey | JETLCJFKNYLDFO-FGZHOGPDSA-N |
| XLogP | 5.66 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|