C33H45NO4 — CID 143314265
4-butyl-N-[(3E,5Z)-7-[4-(2-ethylpentanoyl)phenyl]octa-1,3,5-trien-4-yl]benzamide;methanediol (PubChem CID 143314265) has the molecular formula C33H45NO4 and a molecular weight of 519.73 g/mol. Its IUPAC name is 4-butyl-N-[(3E,5Z)-7-[4-(2-ethylpentanoyl)phenyl]octa-1,3,5-trien-4-yl]benzamide;methanediol.
| Compound Name | 4-butyl-N-[(3E,5Z)-7-[4-(2-ethylpentanoyl)phenyl]octa-1,3,5-trien-4-yl]benzamide;methanediol |
|---|---|
| PubChem CID | 143314265 |
| Molecular Formula | C33H45NO4 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | 4-butyl-N-[(3E,5Z)-7-[4-(2-ethylpentanoyl)phenyl]octa-1,3,5-trien-4-yl]benzamide;methanediol |
| SMILES | C=C/C=C(\C=C/C(C)c1ccc(C(=O)C(CC)CCC)cc1)NC(=O)c1ccc(CCCC)cc1.OCO |
| InChI | InChI=1S/C32H41NO2.CH4O2/c1-6-10-13-25-15-17-29(18-16-25)32(35)33-30(12-8-3)23-14-24(5)27-19-21-28(22-20-27)31(34)26(9-4)11-7-2;2-1-3/h8,12,14-24,26H,3,6-7,9-11,13H2,1-2,4-5H3,(H,33,35);2-3H,1H2/b23-14-,30-12+; |
| InChIKey | HUINMUFIMWFPRR-NTLNGXDASA-N |
| XLogP | 7.13 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|