C30H53N5O6 — CID 143315138
(2S)-1-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-N-(2-oxopropyl)pyrrolidine-2-carboxamide;propane;N-prop-2-enylformamide (PubChem CID 143315138) has the molecular formula C30H53N5O6 and a molecular weight of 579.78 g/mol. Its IUPAC name is (2S)-1-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-N-(2-oxopropyl)pyrrolidine-2-carboxamide;propane;N-prop-2-enylformamide.
| Compound Name | (2S)-1-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-N-(2-oxopropyl)pyrrolidine-2-carboxamide;propane;N-prop-2-enylformamide |
|---|---|
| PubChem CID | 143315138 |
| Molecular Formula | C30H53N5O6 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.40 |
| IUPAC Name | (2S)-1-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-N-(2-oxopropyl)pyrrolidine-2-carboxamide;propane;N-prop-2-enylformamide |
| SMILES | C=CCNC=O.CC(=O)CNC(=O)[C@@H]1CCCN1C(=O)C(NC(=O)NC(C(=O)C1CC1)C(C)C)C(C)(C)C.CCC |
| InChI | InChI=1S/C23H38N4O5.C4H7NO.C3H8/c1-13(2)17(18(29)15-9-10-15)25-22(32)26-19(23(4,5)6)21(31)27-11-7-8-16(27)20(30)24-12-14(3)28;1-2-3-5-4-6;1-3-2/h13,15-17,19H,7-12H2,1-6H3,(H,24,30)(H2,25,26,32);2,4H,1,3H2,(H,5,6);3H2,1-2H3/t16-,17?,19?;;/m0../s1 |
| InChIKey | RRDMVWDCXDLKMH-PZYDZGEOSA-N |
| XLogP | 2.73 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|