About (3-amino-2-oxohexyl) hypofluorite
(3-amino-2-oxohexyl) hypofluorite (PubChem CID 143315142) has the molecular formula C6H12FNO2
and a molecular weight of 149.16 g/mol. Its IUPAC name is (3-amino-2-oxohexyl) hypofluorite.
Molecular Properties
| Compound Name | (3-amino-2-oxohexyl) hypofluorite |
| PubChem CID | 143315142 |
| Molecular Formula | C6H12FNO2 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.09 |
| IUPAC Name | (3-amino-2-oxohexyl) hypofluorite |
| SMILES | CCCC(N)C(=O)COF |
| InChI | InChI=1S/C6H12FNO2/c1-2-3-5(8)6(9)4-10-7/h5H,2-4,8H2,1H3 |
| InChIKey | ZTIUMVYEEWKQIS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-amino-2-oxohexyl) hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-2-oxohexyl) hypofluorite?
The IUPAC name of (3-amino-2-oxohexyl) hypofluorite (CID 143315142) is (3-amino-2-oxohexyl) hypofluorite.
What is the SMILES notation for (3-amino-2-oxohexyl) hypofluorite?
The canonical SMILES for (3-amino-2-oxohexyl) hypofluorite is CCCC(N)C(=O)COF.
What is the InChIKey of (3-amino-2-oxohexyl) hypofluorite?
The InChIKey is ZTIUMVYEEWKQIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FNO2/c1-2-3-5(8)6(9)4-10-7/h5H,2-4,8H2,1H3.
What are the key properties of (3-amino-2-oxohexyl) hypofluorite?
(3-amino-2-oxohexyl) hypofluorite has a molecular weight of 149.16 g/mol, XLogP of 0.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-2-oxohexyl) hypofluorite is sourced from PubChem (CID 143315142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).