C25H37N5O4S — CID 143316008
4-[amino(3,3-dimethylbutanoyl)amino]-N-(3-ethyl-1,3-thiazol-2-ylidene)-3-methoxybenzamide;1-[(2S)-pyrrolidin-2-yl]ethanone (PubChem CID 143316008) has the molecular formula C25H37N5O4S and a molecular weight of 503.67 g/mol. Its IUPAC name is 4-[amino(3,3-dimethylbutanoyl)amino]-N-(3-ethyl-1,3-thiazol-2-ylidene)-3-methoxybenzamide;1-[(2S)-pyrrolidin-2-yl]ethanone.
| Compound Name | 4-[amino(3,3-dimethylbutanoyl)amino]-N-(3-ethyl-1,3-thiazol-2-ylidene)-3-methoxybenzamide;1-[(2S)-pyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 143316008 |
| Molecular Formula | C25H37N5O4S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 4-[amino(3,3-dimethylbutanoyl)amino]-N-(3-ethyl-1,3-thiazol-2-ylidene)-3-methoxybenzamide;1-[(2S)-pyrrolidin-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CCCN1.CCn1ccs/c1=N/C(=O)c1ccc(N(N)C(=O)CC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C19H26N4O3S.C6H11NO/c1-6-22-9-10-27-18(22)21-17(25)13-7-8-14(15(11-13)26-5)23(20)16(24)12-19(2,3)4;1-5(8)6-3-2-4-7-6/h7-11H,6,12,20H2,1-5H3;6-7H,2-4H2,1H3/b21-18+;/t;6-/m.0/s1 |
| InChIKey | YBEGRFJBEACDPH-NXCBGSRASA-N |
| XLogP | 3.29 |
| TPSA | 119.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|