C16H23Cl — CID 143316437
4-chloro-1-(2,5-dimethylhex-1-en-3-yl)-2-ethylbenzene (PubChem CID 143316437) has the molecular formula C16H23Cl and a molecular weight of 250.81 g/mol. Its IUPAC name is 4-chloro-1-(2,5-dimethylhex-1-en-3-yl)-2-ethylbenzene.
| Compound Name | 4-chloro-1-(2,5-dimethylhex-1-en-3-yl)-2-ethylbenzene |
|---|---|
| PubChem CID | 143316437 |
| Molecular Formula | C16H23Cl |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-chloro-1-(2,5-dimethylhex-1-en-3-yl)-2-ethylbenzene |
| SMILES | C=C(C)C(CC(C)C)c1ccc(Cl)cc1CC |
| InChI | InChI=1S/C16H23Cl/c1-6-13-10-14(17)7-8-15(13)16(12(4)5)9-11(2)3/h7-8,10-11,16H,4,6,9H2,1-3,5H3 |
| InChIKey | DSZOVFIPYOXSHF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|