C25H30F4N2O3 — CID 143317112
(3aS,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindole;4-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 143317112) has the molecular formula C25H30F4N2O3 and a molecular weight of 482.52 g/mol. Its IUPAC name is (3aS,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindole;4-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | (3aS,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindole;4-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 143317112 |
| Molecular Formula | C25H30F4N2O3 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (3aS,7aR)-7a-(3,4-dimethoxyphenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindole;4-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | COc1ccc([C@@]23CCCC[C@@H]2CN(C)C3)cc1OC.NC(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H25NO2.C8H5F4NO/c1-18-11-14-6-4-5-9-17(14,12-18)13-7-8-15(19-2)16(10-13)20-3;9-6-2-1-4(7(13)14)3-5(6)8(10,11)12/h7-8,10,14H,4-6,9,11-12H2,1-3H3;1-3H,(H2,13,14)/t14-,17+;/m1./s1 |
| InChIKey | DJIACISPBTZMJH-CVLQQERVSA-N |
| XLogP | 5.02 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |