C51H90N2O3 — CID 143317326
(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2-[(3,5-ditert-butylphenyl)methyl]-2-[1-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)oxyethenyl]decanoate (PubChem CID 143317326) has the molecular formula C51H90N2O3 and a molecular weight of 779.29 g/mol. Its IUPAC name is (2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2-[(3,5-ditert-butylphenyl)methyl]-2-[1-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)oxyethenyl]decanoate.
| Compound Name | (2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2-[(3,5-ditert-butylphenyl)methyl]-2-[1-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)oxyethenyl]decanoate |
|---|---|
| PubChem CID | 143317326 |
| Molecular Formula | C51H90N2O3 |
| Molecular Weight | 779.29 g/mol |
| Exact Mass | 778.70 |
| IUPAC Name | (2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2-[(3,5-ditert-butylphenyl)methyl]-2-[1-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)oxyethenyl]decanoate |
| SMILES | C=C(OC1CC(C)(CC)NC(C)(CC)C1C)C(CCCCCCCC)(Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1)C(=O)OC1CC(C)(CC)NC(C)(CC)C1C |
| InChI | InChI=1S/C51H90N2O3/c1-19-24-25-26-27-28-29-51(33-39-30-40(45(9,10)11)32-41(31-39)46(12,13)14,38(8)55-42-34-47(15,20-2)52-49(17,22-4)36(42)6)44(54)56-43-35-48(16,21-3)53-50(18,23-5)37(43)7/h30-32,36-37,42-43,52-53H,8,19-29,33-35H2,1-7,9-18H3 |
| InChIKey | OTHGQQLRRANODD-UHFFFAOYSA-N |
| XLogP | 13.31 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.29 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|