C46H76N2O4 — CID 143317338
1-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)-3-[1-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)oxyethenyl]-3-[(3,5-ditert-butylphenyl)methyl]heptan-2-one (PubChem CID 143317338) has the molecular formula C46H76N2O4 and a molecular weight of 721.12 g/mol. Its IUPAC name is 1-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)-3-[1-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)oxyethenyl]-3-[(3,5-ditert-butylphenyl)methyl]heptan-2-one.
| Compound Name | 1-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)-3-[1-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)oxyethenyl]-3-[(3,5-ditert-butylphenyl)methyl]heptan-2-one |
|---|---|
| PubChem CID | 143317338 |
| Molecular Formula | C46H76N2O4 |
| Molecular Weight | 721.12 g/mol |
| Exact Mass | 720.58 |
| IUPAC Name | 1-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)-3-[1-(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl)oxyethenyl]-3-[(3,5-ditert-butylphenyl)methyl]heptan-2-one |
| SMILES | C=C(OC1CC(C)(C)N(C(C)=O)C(C)(C)C1)C(CCCC)(Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1)C(=O)CC1CC(C)(C)N(C(C)=O)C(C)(C)C1 |
| InChI | InChI=1S/C46H76N2O4/c1-19-20-21-46(28-34-22-36(40(5,6)7)25-37(23-34)41(8,9)10,31(2)52-38-29-44(15,16)48(33(4)50)45(17,18)30-38)39(51)24-35-26-42(11,12)47(32(3)49)43(13,14)27-35/h22-23,25,35,38H,2,19-21,24,26-30H2,1,3-18H3 |
| InChIKey | ZQFSYMJUTKPSKE-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.12 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|