About 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite
2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite (PubChem CID 143317608) has the molecular formula C20H31FN4O3S
and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite.
Molecular Properties
| Compound Name | 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite |
| PubChem CID | 143317608 |
| Molecular Formula | C20H31FN4O3S |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite |
| SMILES | CC1CN(C)CCCN1.CCC(N)C=O.OSc1cccc2cncc(OF)c12 |
| InChI | InChI=1S/C9H6FNO2S.C7H16N2.C4H9NO/c10-13-7-5-11-4-6-2-1-3-8(14-12)9(6)7;1-7-6-9(2)5-3-4-8-7;1-2-4(5)3-6/h1-5,12H;7-8H,3-6H2,1-2H3;3-4H,2,5H2,1H3 |
| InChIKey | KEGGVWUWKPEUTH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite?
The IUPAC name of 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite (CID 143317608) is 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite.
What is the SMILES notation for 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite?
The canonical SMILES for 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite is CC1CN(C)CCCN1.CCC(N)C=O.OSc1cccc2cncc(OF)c12.
What is the InChIKey of 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite?
The InChIKey is KEGGVWUWKPEUTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNO2S.C7H16N2.C4H9NO/c10-13-7-5-11-4-6-2-1-3-8(14-12)9(6)7;1-7-6-9(2)5-3-4-8-7;1-2-4(5)3-6/h1-5,12H;7-8H,3-6H2,1-2H3;3-4H,2,5H2,1H3.
What are the key properties of 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite?
2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite has a molecular weight of 426.56 g/mol, XLogP of 3.29, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutanal;1,3-dimethyl-1,4-diazepane;(5-hydroxysulfanylisoquinolin-4-yl) hypofluorite is sourced from PubChem (CID 143317608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).