C12H16N2O2S — CID 143317667
2-[(3Z)-5-methoxy-6-methylhepta-1,3,5-trien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole (PubChem CID 143317667) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-[(3Z)-5-methoxy-6-methylhepta-1,3,5-trien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-[(3Z)-5-methoxy-6-methylhepta-1,3,5-trien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143317667 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-[(3Z)-5-methoxy-6-methylhepta-1,3,5-trien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole |
| SMILES | C=C(/C=C\C(OC)=C(C)C)c1nnc(SC)o1 |
| InChI | InChI=1S/C12H16N2O2S/c1-8(2)10(15-4)7-6-9(3)11-13-14-12(16-11)17-5/h6-7H,3H2,1-2,4-5H3/b7-6- |
| InChIKey | YDBSGDHVGJSNNI-SREVYHEPSA-N |
| XLogP | 3.30 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|