C17H22N2 — CID 143318035
N'-ethenyl-N-[(2Z,4Z)-hepta-2,4,6-trienyl]-N-methyl-N'-phenylmethanediamine (PubChem CID 143318035) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N'-ethenyl-N-[(2Z,4Z)-hepta-2,4,6-trienyl]-N-methyl-N'-phenylmethanediamine.
| Compound Name | N'-ethenyl-N-[(2Z,4Z)-hepta-2,4,6-trienyl]-N-methyl-N'-phenylmethanediamine |
|---|---|
| PubChem CID | 143318035 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N'-ethenyl-N-[(2Z,4Z)-hepta-2,4,6-trienyl]-N-methyl-N'-phenylmethanediamine |
| SMILES | C=C/C=C\C=C/CN(C)CN(C=C)c1ccccc1 |
| InChI | InChI=1S/C17H22N2/c1-4-6-7-8-12-15-18(3)16-19(5-2)17-13-10-9-11-14-17/h4-14H,1-2,15-16H2,3H3/b7-6-,12-8- |
| InChIKey | LKAZBCLQHTVPJT-IJDSZTBYSA-N |
| XLogP | 3.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|