About N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide
N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide (PubChem CID 143318235) has the molecular formula C12H23F2N3
and a molecular weight of 247.33 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide |
| PubChem CID | 143318235 |
| Molecular Formula | C12H23F2N3 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide |
| SMILES | CCCNCC/N=C/NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H23F2N3/c1-2-7-15-8-9-16-10-17-11-3-5-12(13,14)6-4-11/h10-11,15H,2-9H2,1H3,(H,16,17) |
| InChIKey | IPCHRXOXRDTJKH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide?
The IUPAC name of N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide (CID 143318235) is N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide?
The canonical SMILES for N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide is CCCNCC/N=C/NC1CCC(F)(F)CC1.
What is the InChIKey of N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide?
The InChIKey is IPCHRXOXRDTJKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F2N3/c1-2-7-15-8-9-16-10-17-11-3-5-12(13,14)6-4-11/h10-11,15H,2-9H2,1H3,(H,16,17).
What are the key properties of N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide?
N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide has a molecular weight of 247.33 g/mol, XLogP of 2.18, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)-N'-[2-(propylamino)ethyl]methanimidamide is sourced from PubChem (CID 143318235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).