C18H30O3 — CID 143318267
(2R,3R)-3-ethyl-2-[(E,2R,3R,5S)-2-hydroxy-3,5-dimethylnon-7-enyl]-2,3-dihydropyran-6-one (PubChem CID 143318267) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (2R,3R)-3-ethyl-2-[(E,2R,3R,5S)-2-hydroxy-3,5-dimethylnon-7-enyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R,3R)-3-ethyl-2-[(E,2R,3R,5S)-2-hydroxy-3,5-dimethylnon-7-enyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 143318267 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (2R,3R)-3-ethyl-2-[(E,2R,3R,5S)-2-hydroxy-3,5-dimethylnon-7-enyl]-2,3-dihydropyran-6-one |
| SMILES | C/C=C/C[C@H](C)C[C@@H](C)[C@H](O)C[C@H]1OC(=O)C=C[C@H]1CC |
| InChI | InChI=1S/C18H30O3/c1-5-7-8-13(3)11-14(4)16(19)12-17-15(6-2)9-10-18(20)21-17/h5,7,9-10,13-17,19H,6,8,11-12H2,1-4H3/b7-5+/t13-,14+,15+,16+,17+/m0/s1 |
| InChIKey | UCYCUVUFUVCSRV-YDTKUEKCSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|