C34H46N4O3 — CID 143318324
4-[[4-(3-hydroxy-4-piperazin-1-ylbutyl)phenyl]-[4-(3-piperazin-1-ylpropoxy)phenyl]methyl]phenol (PubChem CID 143318324) has the molecular formula C34H46N4O3 and a molecular weight of 558.77 g/mol. Its IUPAC name is 4-[[4-(3-hydroxy-4-piperazin-1-ylbutyl)phenyl]-[4-(3-piperazin-1-ylpropoxy)phenyl]methyl]phenol.
| Compound Name | 4-[[4-(3-hydroxy-4-piperazin-1-ylbutyl)phenyl]-[4-(3-piperazin-1-ylpropoxy)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 143318324 |
| Molecular Formula | C34H46N4O3 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | 4-[[4-(3-hydroxy-4-piperazin-1-ylbutyl)phenyl]-[4-(3-piperazin-1-ylpropoxy)phenyl]methyl]phenol |
| SMILES | Oc1ccc(C(c2ccc(CCC(O)CN3CCNCC3)cc2)c2ccc(OCCCN3CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C34H46N4O3/c39-31-12-7-29(8-13-31)34(30-9-14-33(15-10-30)41-25-1-20-37-21-16-35-17-22-37)28-5-2-27(3-6-28)4-11-32(40)26-38-23-18-36-19-24-38/h2-3,5-10,12-15,32,34-36,39-40H,1,4,11,16-26H2 |
| InChIKey | XRUHHHUNUUKSPP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|