C29H35N7O3 — CID 143318834
13-(1-aminoethenyl)-2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-(methylaminocarbamoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide (PubChem CID 143318834) has the molecular formula C29H35N7O3 and a molecular weight of 529.65 g/mol. Its IUPAC name is 13-(1-aminoethenyl)-2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-(methylaminocarbamoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide.
| Compound Name | 13-(1-aminoethenyl)-2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-(methylaminocarbamoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide |
|---|---|
| PubChem CID | 143318834 |
| Molecular Formula | C29H35N7O3 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 13-(1-aminoethenyl)-2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-(methylaminocarbamoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide |
| SMILES | C=C(N)c1ccc2c(c1)CCc1cc(C(N)=O)ccc1C2(CCNCC(=O)N1CCC[C@H]1C#N)C(=O)NNC |
| InChI | InChI=1S/C29H35N7O3/c1-18(31)19-7-9-24-20(14-19)5-6-21-15-22(27(32)38)8-10-25(21)29(24,28(39)35-33-2)11-12-34-17-26(37)36-13-3-4-23(36)16-30/h7-10,14-15,23,33-34H,1,3-6,11-13,17,31H2,2H3,(H2,32,38)(H,35,39)/t23-,29?/m0/s1 |
| InChIKey | CERXAXHDEDYVAV-QASNXKAYSA-N |
| XLogP | 0.84 |
| TPSA | 166.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|