C19H27NO3 — CID 143319979
[(5E)-5-[(3Z,6Z)-7-methoxy-5-methylidene-6-[(Z)-prop-1-enyl]nona-3,6,8-trienylidene]-1,4-dioxan-2-yl]methanamine (PubChem CID 143319979) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is [(5E)-5-[(3Z,6Z)-7-methoxy-5-methylidene-6-[(Z)-prop-1-enyl]nona-3,6,8-trienylidene]-1,4-dioxan-2-yl]methanamine.
| Compound Name | [(5E)-5-[(3Z,6Z)-7-methoxy-5-methylidene-6-[(Z)-prop-1-enyl]nona-3,6,8-trienylidene]-1,4-dioxan-2-yl]methanamine |
|---|---|
| PubChem CID | 143319979 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [(5E)-5-[(3Z,6Z)-7-methoxy-5-methylidene-6-[(Z)-prop-1-enyl]nona-3,6,8-trienylidene]-1,4-dioxan-2-yl]methanamine |
| SMILES | C=C/C(OC)=C(\C=C/C)C(=C)/C=C\C/C=C1\COC(CN)CO1 |
| InChI | InChI=1S/C19H27NO3/c1-5-9-18(19(6-2)21-4)15(3)10-7-8-11-16-13-23-17(12-20)14-22-16/h5-7,9-11,17H,2-3,8,12-14,20H2,1,4H3/b9-5-,10-7-,16-11+,19-18- |
| InChIKey | BPLAVHUPPCKYJQ-LCFIHSGHSA-N |
| XLogP | 3.41 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|