About ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol
ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol (PubChem CID 143321132) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol.
Molecular Properties
| Compound Name | ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol |
| PubChem CID | 143321132 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol |
| SMILES | C=C.C=C/C(=C\C)NCCO |
| InChI | InChI=1S/C7H13NO.C2H4/c1-3-7(4-2)8-5-6-9;1-2/h3-4,8-9H,1,5-6H2,2H3;1-2H2/b7-4+; |
| InChIKey | VJULFSMAHWWENU-KQGICBIGSA-N |
| XLogP | 1.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol?
The IUPAC name of ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol (CID 143321132) is ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol.
What is the SMILES notation for ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol?
The canonical SMILES for ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol is C=C.C=C/C(=C\C)NCCO.
What is the InChIKey of ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol?
The InChIKey is VJULFSMAHWWENU-KQGICBIGSA-N. The full InChI is InChI=1S/C7H13NO.C2H4/c1-3-7(4-2)8-5-6-9;1-2/h3-4,8-9H,1,5-6H2,2H3;1-2H2/b7-4+;.
What are the key properties of ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol?
ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol has a molecular weight of 155.24 g/mol, XLogP of 1.46, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-[[(3E)-penta-1,3-dien-3-yl]amino]ethanol is sourced from PubChem (CID 143321132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).