C30H25FN4O5 — CID 143321202
N-[4-[(6,7-dihydroxyquinolin-4-yl)methyl]-3-fluorophenyl]-5-methyl-3-oxo-1-(2-oxopropyl)-2-phenylpyrazole-4-carboxamide (PubChem CID 143321202) has the molecular formula C30H25FN4O5 and a molecular weight of 540.55 g/mol. Its IUPAC name is N-[4-[(6,7-dihydroxyquinolin-4-yl)methyl]-3-fluorophenyl]-5-methyl-3-oxo-1-(2-oxopropyl)-2-phenylpyrazole-4-carboxamide.
| Compound Name | N-[4-[(6,7-dihydroxyquinolin-4-yl)methyl]-3-fluorophenyl]-5-methyl-3-oxo-1-(2-oxopropyl)-2-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 143321202 |
| Molecular Formula | C30H25FN4O5 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | N-[4-[(6,7-dihydroxyquinolin-4-yl)methyl]-3-fluorophenyl]-5-methyl-3-oxo-1-(2-oxopropyl)-2-phenylpyrazole-4-carboxamide |
| SMILES | CC(=O)Cn1c(C)c(C(=O)Nc2ccc(Cc3ccnc4cc(O)c(O)cc34)c(F)c2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C30H25FN4O5/c1-17(36)16-34-18(2)28(30(40)35(34)22-6-4-3-5-7-22)29(39)33-21-9-8-20(24(31)13-21)12-19-10-11-32-25-15-27(38)26(37)14-23(19)25/h3-11,13-15,37-38H,12,16H2,1-2H3,(H,33,39) |
| InChIKey | VGTUKDOPGNXXSB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|