About methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium
methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium (PubChem CID 143321971) has the molecular formula C8H14N+
and a molecular weight of 124.21 g/mol. Its IUPAC name is methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium.
Molecular Properties
| Compound Name | methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium |
| PubChem CID | 143321971 |
| Molecular Formula | C8H14N+ |
| Molecular Weight | 124.21 g/mol |
| Exact Mass | 124.11 |
| IUPAC Name | methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium |
| SMILES | C=CC(C)/C=C\C=[NH+]\C |
| InChI | InChI=1S/C8H13N/c1-4-8(2)6-5-7-9-3/h4-8H,1H2,2-3H3/p+1/b6-5-,9-7+ |
| InChIKey | UFULDSQIMCOMBY-BZWSEGBZSA-O |
| XLogP | 0.15 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium?
The IUPAC name of methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium (CID 143321971) is methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium.
What is the SMILES notation for methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium?
The canonical SMILES for methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium is C=CC(C)/C=C\C=[NH+]\C.
What is the InChIKey of methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium?
The InChIKey is UFULDSQIMCOMBY-BZWSEGBZSA-O. The full InChI is InChI=1S/C8H13N/c1-4-8(2)6-5-7-9-3/h4-8H,1H2,2-3H3/p+1/b6-5-,9-7+.
What are the key properties of methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium?
methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium has a molecular weight of 124.21 g/mol, XLogP of 0.15, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[(2Z)-4-methylhexa-2,5-dienylidene]azanium is sourced from PubChem (CID 143321971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).