C19H30N2O3 — CID 143322076
N-hydroxy-N'-methyl-N'-[(2-propylphenyl)methyl]octanediamide (PubChem CID 143322076) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-hydroxy-N'-methyl-N'-[(2-propylphenyl)methyl]octanediamide.
| Compound Name | N-hydroxy-N'-methyl-N'-[(2-propylphenyl)methyl]octanediamide |
|---|---|
| PubChem CID | 143322076 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | N-hydroxy-N'-methyl-N'-[(2-propylphenyl)methyl]octanediamide |
| SMILES | CCCc1ccccc1CN(C)C(=O)CCCCCCC(=O)NO |
| InChI | InChI=1S/C19H30N2O3/c1-3-10-16-11-8-9-12-17(16)15-21(2)19(23)14-7-5-4-6-13-18(22)20-24/h8-9,11-12,24H,3-7,10,13-15H2,1-2H3,(H,20,22) |
| InChIKey | FRAADRCFJLQYBD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|