C23H33NO — CID 143322445
(3S)-1-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]cyclohepta-1,3,6-trien-1-yl]oxypropyl]-3-methylpiperidine (PubChem CID 143322445) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is (3S)-1-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]cyclohepta-1,3,6-trien-1-yl]oxypropyl]-3-methylpiperidine.
| Compound Name | (3S)-1-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]cyclohepta-1,3,6-trien-1-yl]oxypropyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 143322445 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (3S)-1-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]cyclohepta-1,3,6-trien-1-yl]oxypropyl]-3-methylpiperidine |
| SMILES | C=C/C=C(\C=C/C)C1=CC=C(OCCCN2CCC[C@H](C)C2)C=CC1 |
| InChI | InChI=1S/C23H33NO/c1-4-9-21(10-5-2)22-12-6-13-23(15-14-22)25-18-8-17-24-16-7-11-20(3)19-24/h4-6,9-10,13-15,20H,1,7-8,11-12,16-19H2,2-3H3/b10-5-,21-9+/t20-/m0/s1 |
| InChIKey | ONNFUWTZLYBGKV-DYROUBGNSA-N |
| XLogP | 5.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|